C7H4Cl2O2Pd+2 — CID 175867579
3,5-dichloro-2-hydroxybenzaldehyde;palladium(2+) (PubChem CID 175867579) has the molecular formula C7H4Cl2O2Pd+2 and a molecular weight of 297.43 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxybenzaldehyde;palladium(2+).
| Compound Name | 3,5-dichloro-2-hydroxybenzaldehyde;palladium(2+) |
|---|---|
| PubChem CID | 175867579 |
| Molecular Formula | C7H4Cl2O2Pd+2 |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | 3,5-dichloro-2-hydroxybenzaldehyde;palladium(2+) |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1O.[Pd+2] |
| InChI | InChI=1S/C7H4Cl2O2.Pd/c8-5-1-4(3-10)7(11)6(9)2-5;/h1-3,11H;/q;+2 |
| InChIKey | WOVABJRSNKSOMP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|