About 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde
3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde (PubChem CID 137412802) has the molecular formula C7H4ClF5O2S
and a molecular weight of 282.62 g/mol. Its IUPAC name is 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde.
Molecular Properties
| Compound Name | 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde |
| PubChem CID | 137412802 |
| Molecular Formula | C7H4ClF5O2S |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde |
| SMILES | O=Cc1cc(S(F)(F)(F)(F)F)cc(Cl)c1O |
| InChI | InChI=1S/C7H4ClF5O2S/c8-6-2-5(16(9,10,11,12)13)1-4(3-14)7(6)15/h1-3,15H |
| InChIKey | GRNRYFMXDQAWHH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde?
The IUPAC name of 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde (CID 137412802) is 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde.
What is the SMILES notation for 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde?
The canonical SMILES for 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde is O=Cc1cc(S(F)(F)(F)(F)F)cc(Cl)c1O.
What is the InChIKey of 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde?
The InChIKey is GRNRYFMXDQAWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClF5O2S/c8-6-2-5(16(9,10,11,12)13)1-4(3-14)7(6)15/h1-3,15H.
What are the key properties of 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde?
3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde has a molecular weight of 282.62 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-hydroxy-5-(pentafluoro-λ6-sulfanyl)benzaldehyde is sourced from PubChem (CID 137412802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).