C8H5ClO3 — CID 177311411
4-chloro-6-hydroxybenzene-1,3-dicarbaldehyde (PubChem CID 177311411) has the molecular formula C8H5ClO3 and a molecular weight of 184.58 g/mol. Its IUPAC name is 4-chloro-6-hydroxybenzene-1,3-dicarbaldehyde.
| Compound Name | 4-chloro-6-hydroxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 177311411 |
| Molecular Formula | C8H5ClO3 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 4-chloro-6-hydroxybenzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)c(Cl)cc1O |
| InChI | InChI=1S/C8H5ClO3/c9-7-2-8(12)6(4-11)1-5(7)3-10/h1-4,12H |
| InChIKey | XJUPZXQIKNMXBP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|