About azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde
azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde (PubChem CID 161490550) has the molecular formula C8H10ClNO3
and a molecular weight of 203.62 g/mol. Its IUPAC name is azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde.
Molecular Properties
| Compound Name | azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde |
| PubChem CID | 161490550 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde |
| SMILES | C=O.N.O=Cc1ccc(Cl)cc1O |
| InChI | InChI=1S/C7H5ClO2.CH2O.H3N/c8-6-2-1-5(4-9)7(10)3-6;1-2;/h1-4,10H;1H2;1H3 |
| InChIKey | DCNJURBEERTGSH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde?
The IUPAC name of azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde (CID 161490550) is azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde.
What is the SMILES notation for azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde?
The canonical SMILES for azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde is C=O.N.O=Cc1ccc(Cl)cc1O.
What is the InChIKey of azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde?
The InChIKey is DCNJURBEERTGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.CH2O.H3N/c8-6-2-1-5(4-9)7(10)3-6;1-2;/h1-4,10H;1H2;1H3.
What are the key properties of azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde?
azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde has a molecular weight of 203.62 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-chloro-2-hydroxybenzaldehyde;formaldehyde is sourced from PubChem (CID 161490550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).