C9H8ClNO3 — CID 136866026
2-[(4-chloro-2-hydroxyphenyl)methylideneamino]acetic acid (PubChem CID 136866026) has the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. Its IUPAC name is 2-[(4-chloro-2-hydroxyphenyl)methylideneamino]acetic acid.
| Compound Name | 2-[(4-chloro-2-hydroxyphenyl)methylideneamino]acetic acid |
|---|---|
| PubChem CID | 136866026 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-[(4-chloro-2-hydroxyphenyl)methylideneamino]acetic acid |
| SMILES | O=C(O)C/N=C/c1ccc(Cl)cc1O |
| InChI | InChI=1S/C9H8ClNO3/c10-7-2-1-6(8(12)3-7)4-11-5-9(13)14/h1-4,12H,5H2,(H,13,14)/b11-4+ |
| InChIKey | DATILTIEQMCQRX-NYYWCZLTSA-N |
| XLogP | 1.55 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|