C9H7BrClNO3 — CID 136811178
2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]acetic acid (PubChem CID 136811178) has the molecular formula C9H7BrClNO3 and a molecular weight of 292.52 g/mol. Its IUPAC name is 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]acetic acid.
| Compound Name | 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]acetic acid |
|---|---|
| PubChem CID | 136811178 |
| Molecular Formula | C9H7BrClNO3 |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]acetic acid |
| SMILES | O=C(O)C/N=C/c1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C9H7BrClNO3/c10-7-2-6(11)1-5(9(7)15)3-12-4-8(13)14/h1-3,15H,4H2,(H,13,14)/b12-3+ |
| InChIKey | LBYKMPMFUQXWGP-KGVSQERTSA-N |
| XLogP | 2.31 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|