C11H14BrClN2O2 — CID 139201615
2-bromo-4-chloro-6-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol (PubChem CID 139201615) has the molecular formula C11H14BrClN2O2 and a molecular weight of 321.60 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol.
| Compound Name | 2-bromo-4-chloro-6-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 139201615 |
| Molecular Formula | C11H14BrClN2O2 |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-bromo-4-chloro-6-[2-(2-hydroxyethylamino)ethyliminomethyl]phenol |
| SMILES | OCCNCC/N=C/c1cc(Cl)cc(Br)c1O |
| InChI | InChI=1S/C11H14BrClN2O2/c12-10-6-9(13)5-8(11(10)17)7-15-2-1-14-3-4-16/h5-7,14,16-17H,1-4H2/b15-7+ |
| InChIKey | TZEQMDSHOHTVNZ-VIZOYTHASA-N |
| XLogP | 1.81 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|