C16H14BrClN2O3 — CID 136826715
2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxy-4-methylphenyl)acetamide (PubChem CID 136826715) has the molecular formula C16H14BrClN2O3 and a molecular weight of 397.66 g/mol. Its IUPAC name is 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxy-4-methylphenyl)acetamide.
| Compound Name | 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 136826715 |
| Molecular Formula | C16H14BrClN2O3 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-[(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxy-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C/N=C/c2cc(Cl)cc(Br)c2O)c(O)c1 |
| InChI | InChI=1S/C16H14BrClN2O3/c1-9-2-3-13(14(21)4-9)20-15(22)8-19-7-10-5-11(18)6-12(17)16(10)23/h2-7,21,23H,8H2,1H3,(H,20,22)/b19-7+ |
| InChIKey | WHQKUHXPKNYMNT-FBCYGCLPSA-N |
| XLogP | 3.88 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|