C23H30N2O3 — CID 136814304
2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxyphenyl)acetamide (PubChem CID 136814304) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 136814304 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-N-(2-hydroxyphenyl)acetamide |
| SMILES | CC(C)(C)c1cc(/C=N/CC(=O)Nc2ccccc2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-22(2,3)16-11-15(21(28)17(12-16)23(4,5)6)13-24-14-20(27)25-18-9-7-8-10-19(18)26/h7-13,26,28H,14H2,1-6H3,(H,25,27)/b24-13+ |
| InChIKey | HALUTBVPYWVDBX-ZMOGYAJESA-N |
| XLogP | 4.75 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|