C36H57N3O2 — CID 136835563
2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propylamino]propyliminomethyl]phenol (PubChem CID 136835563) has the molecular formula C36H57N3O2 and a molecular weight of 563.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propylamino]propyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propylamino]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 136835563 |
| Molecular Formula | C36H57N3O2 |
| Molecular Weight | 563.87 g/mol |
| Exact Mass | 563.45 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propylamino]propyliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/CCCNCCC/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H57N3O2/c1-33(2,3)27-19-25(31(40)29(21-27)35(7,8)9)23-38-17-13-15-37-16-14-18-39-24-26-20-28(34(4,5)6)22-30(32(26)41)36(10,11)12/h19-24,37,40-41H,13-18H2,1-12H3/b38-23+,39-24+ |
| InChIKey | JHKDNZCGQXLQBE-JMJMRPKZSA-N |
| XLogP | 8.20 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.87 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|