C37H59N3O2 — CID 136790281
2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyl-methylamino]propyliminomethyl]phenol (PubChem CID 136790281) has the molecular formula C37H59N3O2 and a molecular weight of 577.90 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyl-methylamino]propyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyl-methylamino]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 136790281 |
| Molecular Formula | C37H59N3O2 |
| Molecular Weight | 577.90 g/mol |
| Exact Mass | 577.46 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propyl-methylamino]propyliminomethyl]phenol |
| SMILES | CN(CCC/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)CCC/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H59N3O2/c1-34(2,3)28-20-26(32(41)30(22-28)36(7,8)9)24-38-16-14-18-40(13)19-15-17-39-25-27-21-29(35(4,5)6)23-31(33(27)42)37(10,11)12/h20-25,41-42H,14-19H2,1-13H3/b38-24+,39-25+ |
| InChIKey | HPKFNHRQBAVVMC-JILWXUFLSA-N |
| XLogP | 8.54 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.90 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|