C25H34I2N2O2 — CID 136703027
2,4-ditert-butyl-6-[2-[(2-hydroxy-3,5-diiodophenyl)methyl-methylamino]ethyliminomethyl]phenol (PubChem CID 136703027) has the molecular formula C25H34I2N2O2 and a molecular weight of 648.37 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[(2-hydroxy-3,5-diiodophenyl)methyl-methylamino]ethyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[(2-hydroxy-3,5-diiodophenyl)methyl-methylamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 136703027 |
| Molecular Formula | C25H34I2N2O2 |
| Molecular Weight | 648.37 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[(2-hydroxy-3,5-diiodophenyl)methyl-methylamino]ethyliminomethyl]phenol |
| SMILES | CN(CC/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)Cc1cc(I)cc(I)c1O |
| InChI | InChI=1S/C25H34I2N2O2/c1-24(2,3)18-10-16(22(30)20(12-18)25(4,5)6)14-28-8-9-29(7)15-17-11-19(26)13-21(27)23(17)31/h10-14,30-31H,8-9,15H2,1-7H3/b28-14+ |
| InChIKey | XYCJHXLXZAFDKA-CCVNUDIWSA-N |
| XLogP | 6.45 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|