C15H22AlNO+2 — CID 173083776
[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]aluminum(2+) (PubChem CID 173083776) has the molecular formula C15H22AlNO+2 and a molecular weight of 259.33 g/mol. Its IUPAC name is [(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]aluminum(2+).
| Compound Name | [(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]aluminum(2+) |
|---|---|
| PubChem CID | 173083776 |
| Molecular Formula | C15H22AlNO+2 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]aluminum(2+) |
| SMILES | CC(C)(C)c1cc(C=N[Al+2])c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22NO.Al/c1-14(2,3)11-7-10(9-16)13(17)12(8-11)15(4,5)6;/h7-9,17H,1-6H3;/q-1;+3 |
| InChIKey | UDEKXJCAIVAXOG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|