C34H51AlN2O2 — CID 173199978
CID 173199978 (PubChem CID 173199978) has the molecular formula C34H51AlN2O2 and a molecular weight of 546.78 g/mol.
| Compound Name | CID 173199978 |
|---|---|
| PubChem CID | 173199978 |
| Molecular Formula | C34H51AlN2O2 |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(/C=N/C=C/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.CC[Al] |
| InChI | InChI=1S/C32H46N2O2.C2H5.Al/c1-29(2,3)23-15-21(27(35)25(17-23)31(7,8)9)19-33-13-14-34-20-22-16-24(30(4,5)6)18-26(28(22)36)32(10,11)12;1-2;/h13-20,35-36H,1-12H3;1H2,2H3;/b14-13?,33-19+,34-20+;; |
| InChIKey | PCOAYTGCMWSLMH-POTRHPTHSA-N |
| XLogP | 8.89 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|