C17H28CoN2O — CID 175001067
2-(2-aminoethyliminomethyl)-4,6-ditert-butylphenol;cobalt (PubChem CID 175001067) has the molecular formula C17H28CoN2O and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-(2-aminoethyliminomethyl)-4,6-ditert-butylphenol;cobalt.
| Compound Name | 2-(2-aminoethyliminomethyl)-4,6-ditert-butylphenol;cobalt |
|---|---|
| PubChem CID | 175001067 |
| Molecular Formula | C17H28CoN2O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(2-aminoethyliminomethyl)-4,6-ditert-butylphenol;cobalt |
| SMILES | CC(C)(C)c1cc(/C=N/CCN)c(O)c(C(C)(C)C)c1.[Co] |
| InChI | InChI=1S/C17H28N2O.Co/c1-16(2,3)13-9-12(11-19-8-7-18)15(20)14(10-13)17(4,5)6;/h9-11,20H,7-8,18H2,1-6H3;/b19-11+; |
| InChIKey | JTACKHZCVZJEBW-YLFUTEQJSA-N |
| XLogP | 3.36 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|