C23H35BrN3NiO — CID 135424911
CID 135424911 (PubChem CID 135424911) has the molecular formula C23H35BrN3NiO and a molecular weight of 508.15 g/mol.
| Compound Name | CID 135424911 |
|---|---|
| PubChem CID | 135424911 |
| Molecular Formula | C23H35BrN3NiO |
| Molecular Weight | 508.15 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | — |
| SMILES | CC(C)N1[C]N(CC/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)C=C1.[Ni]Br |
| InChI | InChI=1S/C23H35N3O.BrH.Ni/c1-17(2)26-12-11-25(16-26)10-9-24-15-18-13-19(22(3,4)5)14-20(21(18)27)23(6,7)8;;/h11-15,17,27H,9-10H2,1-8H3;1H;/q;;+1/p-1/b24-15+;; |
| InChIKey | LZFOSPWDGWHMKA-PCLWTAJYSA-M |
| XLogP | 5.74 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|