C34H52N2O2 — CID 137148529
2-tert-butyl-6-[2-[[3-tert-butyl-2-hydroxy-5-(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4-(3-methylbutyl)phenol (PubChem CID 137148529) has the molecular formula C34H52N2O2 and a molecular weight of 520.80 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-[[3-tert-butyl-2-hydroxy-5-(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4-(3-methylbutyl)phenol.
| Compound Name | 2-tert-butyl-6-[2-[[3-tert-butyl-2-hydroxy-5-(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4-(3-methylbutyl)phenol |
|---|---|
| PubChem CID | 137148529 |
| Molecular Formula | C34H52N2O2 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.40 |
| IUPAC Name | 2-tert-butyl-6-[2-[[3-tert-butyl-2-hydroxy-5-(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4-(3-methylbutyl)phenol |
| SMILES | CC(C)CCc1cc(/C=N/CC/N=C/c2cc(CCC(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H52N2O2/c1-23(2)11-13-25-17-27(31(37)29(19-25)33(5,6)7)21-35-15-16-36-22-28-18-26(14-12-24(3)4)20-30(32(28)38)34(8,9)10/h17-24,37-38H,11-16H2,1-10H3/b35-21+,36-22+ |
| InChIKey | NQRGAVNCXHIMLH-JTOYJDTJSA-N |
| XLogP | 8.41 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|