C36H56N2O2 — CID 137037636
2-[2-[[2-hydroxy-3,5-bis(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4,6-bis(3-methylbutyl)phenol (PubChem CID 137037636) has the molecular formula C36H56N2O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is 2-[2-[[2-hydroxy-3,5-bis(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4,6-bis(3-methylbutyl)phenol.
| Compound Name | 2-[2-[[2-hydroxy-3,5-bis(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4,6-bis(3-methylbutyl)phenol |
|---|---|
| PubChem CID | 137037636 |
| Molecular Formula | C36H56N2O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | 2-[2-[[2-hydroxy-3,5-bis(3-methylbutyl)phenyl]methylideneamino]ethyliminomethyl]-4,6-bis(3-methylbutyl)phenol |
| SMILES | CC(C)CCc1cc(/C=N/CC/N=C/c2cc(CCC(C)C)cc(CCC(C)C)c2O)c(O)c(CCC(C)C)c1 |
| InChI | InChI=1S/C36H56N2O2/c1-25(2)9-13-29-19-31(15-11-27(5)6)35(39)33(21-29)23-37-17-18-38-24-34-22-30(14-10-26(3)4)20-32(36(34)40)16-12-28(7)8/h19-28,39-40H,9-18H2,1-8H3/b37-23+,38-24+ |
| InChIKey | DEMHAERDQMXALT-DNJOOXRZSA-N |
| XLogP | 8.99 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|