C29H42N2O2 — CID 137061127
2-[3-[[2-hydroxy-3-methyl-5-(3-methylbutyl)phenyl]methylideneamino]propyliminomethyl]-6-methyl-4-(3-methylbutyl)phenol (PubChem CID 137061127) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2-[3-[[2-hydroxy-3-methyl-5-(3-methylbutyl)phenyl]methylideneamino]propyliminomethyl]-6-methyl-4-(3-methylbutyl)phenol.
| Compound Name | 2-[3-[[2-hydroxy-3-methyl-5-(3-methylbutyl)phenyl]methylideneamino]propyliminomethyl]-6-methyl-4-(3-methylbutyl)phenol |
|---|---|
| PubChem CID | 137061127 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 2-[3-[[2-hydroxy-3-methyl-5-(3-methylbutyl)phenyl]methylideneamino]propyliminomethyl]-6-methyl-4-(3-methylbutyl)phenol |
| SMILES | Cc1cc(CCC(C)C)cc(/C=N/CCC/N=C/c2cc(CCC(C)C)cc(C)c2O)c1O |
| InChI | InChI=1S/C29H42N2O2/c1-20(2)8-10-24-14-22(5)28(32)26(16-24)18-30-12-7-13-31-19-27-17-25(11-9-21(3)4)15-23(6)29(27)33/h14-21,32-33H,7-13H2,1-6H3/b30-18+,31-19+ |
| InChIKey | QCALWDBRCBSTIK-GFTXTJKWSA-N |
| XLogP | 6.82 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|