About bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane
bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane (PubChem CID 172929210) has the molecular formula C35H58N2O4
and a molecular weight of 570.86 g/mol. Its IUPAC name is bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane.
Molecular Properties
| Compound Name | bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane |
| PubChem CID | 172929210 |
| Molecular Formula | C35H58N2O4 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.44 |
| IUPAC Name | bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane |
| SMILES | C.CCCCCCCCCc1cc(C)c(O)c(/C=N\O)c1.CCCCCCCCCc1cc(C)c(O)c(/C=N\O)c1 |
| InChI | InChI=1S/2C17H27NO2.CH4/c2*1-3-4-5-6-7-8-9-10-15-11-14(2)17(19)16(12-15)13-18-20;/h2*11-13,19-20H,3-10H2,1-2H3;1H4/b2*18-13-; |
| InChIKey | IRTOZLPXBSKKDC-RENOKAIYSA-N |
| XLogP | 10.24 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane?
The IUPAC name of bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane (CID 172929210) is bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane.
What is the SMILES notation for bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane?
The canonical SMILES for bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane is C.CCCCCCCCCc1cc(C)c(O)c(/C=N\O)c1.CCCCCCCCCc1cc(C)c(O)c(/C=N\O)c1.
What is the InChIKey of bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane?
The InChIKey is IRTOZLPXBSKKDC-RENOKAIYSA-N. The full InChI is InChI=1S/2C17H27NO2.CH4/c2*1-3-4-5-6-7-8-9-10-15-11-14(2)17(19)16(12-15)13-18-20;/h2*11-13,19-20H,3-10H2,1-2H3;1H4/b2*18-13-;.
What are the key properties of bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane?
bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane has a molecular weight of 570.86 g/mol, XLogP of 10.24, 18 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(Z)-hydroxyiminomethyl]-6-methyl-4-nonylphenol);methane is sourced from PubChem (CID 172929210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).