C30H36N2O2 — CID 137143929
4-butyl-2-[[4-[(5-butyl-2-hydroxy-3-methylphenyl)methylideneamino]phenyl]iminomethyl]-6-methylphenol (PubChem CID 137143929) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-butyl-2-[[4-[(5-butyl-2-hydroxy-3-methylphenyl)methylideneamino]phenyl]iminomethyl]-6-methylphenol.
| Compound Name | 4-butyl-2-[[4-[(5-butyl-2-hydroxy-3-methylphenyl)methylideneamino]phenyl]iminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 137143929 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 4-butyl-2-[[4-[(5-butyl-2-hydroxy-3-methylphenyl)methylideneamino]phenyl]iminomethyl]-6-methylphenol |
| SMILES | CCCCc1cc(C)c(O)c(/C=N/c2ccc(/N=C/c3cc(CCCC)cc(C)c3O)cc2)c1 |
| InChI | InChI=1S/C30H36N2O2/c1-5-7-9-23-15-21(3)29(33)25(17-23)19-31-27-11-13-28(14-12-27)32-20-26-18-24(10-8-6-2)16-22(4)30(26)34/h11-20,33-34H,5-10H2,1-4H3/b31-19+,32-20+ |
| InChIKey | HEIMMXBHLKOVTF-GKTLAHRSSA-N |
| XLogP | 7.90 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|