C32H40N2O2 — CID 137130350
2-[[4-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]phenyl]iminomethyl]-4,6-dipropylphenol (PubChem CID 137130350) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-[[4-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]phenyl]iminomethyl]-4,6-dipropylphenol.
| Compound Name | 2-[[4-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]phenyl]iminomethyl]-4,6-dipropylphenol |
|---|---|
| PubChem CID | 137130350 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 2-[[4-[(2-hydroxy-3,5-dipropylphenyl)methylideneamino]phenyl]iminomethyl]-4,6-dipropylphenol |
| SMILES | CCCc1cc(/C=N/c2ccc(/N=C/c3cc(CCC)cc(CCC)c3O)cc2)c(O)c(CCC)c1 |
| InChI | InChI=1S/C32H40N2O2/c1-5-9-23-17-25(11-7-3)31(35)27(19-23)21-33-29-13-15-30(16-14-29)34-22-28-20-24(10-6-2)18-26(12-8-4)32(28)36/h13-22,35-36H,5-12H2,1-4H3/b33-21+,34-22+ |
| InChIKey | NIXPJIGJHRMTPV-WXGDAXOSSA-N |
| XLogP | 8.41 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|