C24H30I2N2O2 — CID 136835032
2-tert-butyl-6-[2-[(3-tert-butyl-2-hydroxy-5-iodophenyl)methylideneamino]ethyliminomethyl]-4-iodophenol (PubChem CID 136835032) has the molecular formula C24H30I2N2O2 and a molecular weight of 632.32 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-[(3-tert-butyl-2-hydroxy-5-iodophenyl)methylideneamino]ethyliminomethyl]-4-iodophenol.
| Compound Name | 2-tert-butyl-6-[2-[(3-tert-butyl-2-hydroxy-5-iodophenyl)methylideneamino]ethyliminomethyl]-4-iodophenol |
|---|---|
| PubChem CID | 136835032 |
| Molecular Formula | C24H30I2N2O2 |
| Molecular Weight | 632.32 g/mol |
| Exact Mass | 632.04 |
| IUPAC Name | 2-tert-butyl-6-[2-[(3-tert-butyl-2-hydroxy-5-iodophenyl)methylideneamino]ethyliminomethyl]-4-iodophenol |
| SMILES | CC(C)(C)c1cc(I)cc(/C=N/CC/N=C/c2cc(I)cc(C(C)(C)C)c2O)c1O |
| InChI | InChI=1S/C24H30I2N2O2/c1-23(2,3)19-11-17(25)9-15(21(19)29)13-27-7-8-28-14-16-10-18(26)12-20(22(16)30)24(4,5)6/h9-14,29-30H,7-8H2,1-6H3/b27-13+,28-14+ |
| InChIKey | XUSHGCXURMOMLG-OCHFTUDZSA-N |
| XLogP | 6.44 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.32 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|