C34H52N2O2 — CID 136814344
2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol (PubChem CID 136814344) has the molecular formula C34H52N2O2 and a molecular weight of 520.80 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol |
|---|---|
| PubChem CID | 136814344 |
| Molecular Formula | C34H52N2O2 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.40 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]butyliminomethyl]phenol |
| SMILES | CC(CC/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H52N2O2/c1-22(36-21-24-17-26(32(5,6)7)19-28(30(24)38)34(11,12)13)14-15-35-20-23-16-25(31(2,3)4)18-27(29(23)37)33(8,9)10/h16-22,37-38H,14-15H2,1-13H3/b35-20+,36-21+ |
| InChIKey | RJDJNCRPJROGPC-CJVLSJCWSA-N |
| XLogP | 8.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|