C33H48N2O4 — CID 139161245
(2R)-2,3-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propanoic acid (PubChem CID 139161245) has the molecular formula C33H48N2O4 and a molecular weight of 536.76 g/mol. Its IUPAC name is (2R)-2,3-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propanoic acid.
| Compound Name | (2R)-2,3-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 139161245 |
| Molecular Formula | C33H48N2O4 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | (2R)-2,3-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]propanoic acid |
| SMILES | CC(C)(C)c1cc(/C=N/C[C@@H](/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)C(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H48N2O4/c1-30(2,3)22-13-20(27(36)24(15-22)32(7,8)9)17-34-19-26(29(38)39)35-18-21-14-23(31(4,5)6)16-25(28(21)37)33(10,11)12/h13-18,26,36-37H,19H2,1-12H3,(H,38,39)/b34-17+,35-18+/t26-/m1/s1 |
| InChIKey | ADJYPFUQZKPVKW-RWSNETCRSA-N |
| XLogP | 7.28 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|