C24H31NO3 — CID 136740415
(2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid (PubChem CID 136740415) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 136740415 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H](Cc2ccccc2)C(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31NO3/c1-23(2,3)18-13-17(21(26)19(14-18)24(4,5)6)15-25-20(22(27)28)12-16-10-8-7-9-11-16/h7-11,13-15,20,26H,12H2,1-6H3,(H,27,28)/b25-15+/t20-/m0/s1 |
| InChIKey | JVIYFTJUPIZVFZ-RASHHNMQSA-N |
| XLogP | 5.10 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|