C40H49Cl2NO3Ti — CID 135455011
2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol;dichlorotitanium;oxolane (PubChem CID 135455011) has the molecular formula C40H49Cl2NO3Ti and a molecular weight of 710.61 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol;dichlorotitanium;oxolane.
| Compound Name | 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol;dichlorotitanium;oxolane |
|---|---|
| PubChem CID | 135455011 |
| Molecular Formula | C40H49Cl2NO3Ti |
| Molecular Weight | 710.61 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol;dichlorotitanium;oxolane |
| SMILES | C1CCOC1.CC(C)(C)c1cc(/C=N\[C@@H](Cc2ccccc2)C(O)(c2ccccc2)c2ccccc2)c(O)c(C(C)(C)C)c1.Cl[Ti]Cl |
| InChI | InChI=1S/C36H41NO2.C4H8O.2ClH.Ti/c1-34(2,3)30-23-27(33(38)31(24-30)35(4,5)6)25-37-32(22-26-16-10-7-11-17-26)36(39,28-18-12-8-13-19-28)29-20-14-9-15-21-29;1-2-4-5-3-1;;;/h7-21,23-25,32,38-39H,22H2,1-6H3;1-4H2;2*1H;/q;;;;+2/p-2/b37-25-;;;;/t32-;;;;/m0..../s1 |
| InChIKey | UQIYBAYZVKUETB-WZSKRUKCSA-L |
| XLogP | 10.13 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.61 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|