C28H24ClNO2 — CID 135934907
2-chloro-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol (PubChem CID 135934907) has the molecular formula C28H24ClNO2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-chloro-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 2-chloro-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135934907 |
| Molecular Formula | C28H24ClNO2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-chloro-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cccc1/C=N/[C@@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24ClNO2/c29-25-18-10-13-22(27(25)31)20-30-26(19-21-11-4-1-5-12-21)28(32,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-18,20,26,31-32H,19H2/b30-20+/t26-/m0/s1 |
| InChIKey | CSKXJGZXGLEJKY-RLBBTWETSA-N |
| XLogP | 6.01 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|