C43H55NO5 — CID 139698035
2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-6-tert-butyl-4-methoxyphenol (PubChem CID 139698035) has the molecular formula C43H55NO5 and a molecular weight of 665.92 g/mol. Its IUPAC name is 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-6-tert-butyl-4-methoxyphenol.
| Compound Name | 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-6-tert-butyl-4-methoxyphenol |
|---|---|
| PubChem CID | 139698035 |
| Molecular Formula | C43H55NO5 |
| Molecular Weight | 665.92 g/mol |
| Exact Mass | 665.41 |
| IUPAC Name | 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-3-phenylpropan-2-yl]iminomethyl]-6-tert-butyl-4-methoxyphenol |
| SMILES | COc1cc(/C=N/C(Cc2ccccc2)C(O)(c2cc(C(C)(C)C)ccc2OC)c2cc(C(C)(C)C)ccc2OC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C43H55NO5/c1-40(2,3)30-18-20-36(48-11)33(24-30)43(46,34-25-31(41(4,5)6)19-21-37(34)49-12)38(22-28-16-14-13-15-17-28)44-27-29-23-32(47-10)26-35(39(29)45)42(7,8)9/h13-21,23-27,38,45-46H,22H2,1-12H3/b44-27+ |
| InChIKey | PUTYZCGTWLCIHR-ZSTTVQMRSA-N |
| XLogP | 9.28 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.92 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|