C28H43NO3 — CID 139698065
2-amino-1,1-bis(5-tert-butyl-2-methoxyphenyl)-4-methylpentan-1-ol (PubChem CID 139698065) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-amino-1,1-bis(5-tert-butyl-2-methoxyphenyl)-4-methylpentan-1-ol.
| Compound Name | 2-amino-1,1-bis(5-tert-butyl-2-methoxyphenyl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 139698065 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 2-amino-1,1-bis(5-tert-butyl-2-methoxyphenyl)-4-methylpentan-1-ol |
| SMILES | COc1ccc(C(C)(C)C)cc1C(O)(c1cc(C(C)(C)C)ccc1OC)C(N)CC(C)C |
| InChI | InChI=1S/C28H43NO3/c1-18(2)15-25(29)28(30,21-16-19(26(3,4)5)11-13-23(21)31-9)22-17-20(27(6,7)8)12-14-24(22)32-10/h11-14,16-18,25,30H,15,29H2,1-10H3 |
| InChIKey | OPDROECQDPULIO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |