C45H59NO5 — CID 139698056
2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-4-(2-methoxyphenyl)butan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol (PubChem CID 139698056) has the molecular formula C45H59NO5 and a molecular weight of 693.97 g/mol. Its IUPAC name is 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-4-(2-methoxyphenyl)butan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-4-(2-methoxyphenyl)butan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 139698056 |
| Molecular Formula | C45H59NO5 |
| Molecular Weight | 693.97 g/mol |
| Exact Mass | 693.44 |
| IUPAC Name | 2-[[1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxy-4-(2-methoxyphenyl)butan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol |
| SMILES | COc1ccccc1CCC(/N=C/c1cc(C)cc(C(C)(C)C)c1O)C(O)(c1cc(C(C)(C)C)ccc1OC)c1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C45H59NO5/c1-29-24-31(41(47)36(25-29)44(8,9)10)28-46-40(23-18-30-16-14-15-17-37(30)49-11)45(48,34-26-32(42(2,3)4)19-21-38(34)50-12)35-27-33(43(5,6)7)20-22-39(35)51-13/h14-17,19-22,24-28,40,47-48H,18,23H2,1-13H3/b46-28+ |
| InChIKey | VMICQEWRSLRASS-HOKWUGLCSA-N |
| XLogP | 9.98 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.97 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|