C47H63NO5 — CID 139698054
2-[[3-(2-butoxyphenyl)-1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol (PubChem CID 139698054) has the molecular formula C47H63NO5 and a molecular weight of 722.02 g/mol. Its IUPAC name is 2-[[3-(2-butoxyphenyl)-1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[[3-(2-butoxyphenyl)-1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 139698054 |
| Molecular Formula | C47H63NO5 |
| Molecular Weight | 722.02 g/mol |
| Exact Mass | 721.47 |
| IUPAC Name | 2-[[3-(2-butoxyphenyl)-1,1-bis(5-tert-butyl-2-methoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-tert-butyl-4-methylphenol |
| SMILES | CCCCOc1ccccc1CC(/N=C/c1cc(C)cc(C(C)(C)C)c1O)C(O)(c1cc(C(C)(C)C)ccc1OC)c1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C47H63NO5/c1-14-15-24-53-39-19-17-16-18-32(39)27-42(48-30-33-25-31(2)26-38(43(33)49)46(9,10)11)47(50,36-28-34(44(3,4)5)20-22-40(36)51-12)37-29-35(45(6,7)8)21-23-41(37)52-13/h16-23,25-26,28-30,42,49-50H,14-15,24,27H2,1-13H3/b48-30+ |
| InChIKey | ZXBVVHZNSUSVPI-MUEODZSNSA-N |
| XLogP | 10.76 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.02 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|