C46H68FNO4 — CID 139933303
2-[[(2R)-1,1-bis(5-tert-butyl-2-octoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-fluorophenol (PubChem CID 139933303) has the molecular formula C46H68FNO4 and a molecular weight of 718.05 g/mol. Its IUPAC name is 2-[[(2R)-1,1-bis(5-tert-butyl-2-octoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-fluorophenol.
| Compound Name | 2-[[(2R)-1,1-bis(5-tert-butyl-2-octoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-fluorophenol |
|---|---|
| PubChem CID | 139933303 |
| Molecular Formula | C46H68FNO4 |
| Molecular Weight | 718.05 g/mol |
| Exact Mass | 717.51 |
| IUPAC Name | 2-[[(2R)-1,1-bis(5-tert-butyl-2-octoxyphenyl)-1-hydroxypropan-2-yl]iminomethyl]-6-fluorophenol |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)C)cc1C(O)(c1cc(C(C)(C)C)ccc1OCCCCCCCC)[C@@H](C)/N=C\c1cccc(F)c1O |
| InChI | InChI=1S/C46H68FNO4/c1-10-12-14-16-18-20-29-51-41-27-25-36(44(4,5)6)31-38(41)46(50,34(3)48-33-35-23-22-24-40(47)43(35)49)39-32-37(45(7,8)9)26-28-42(39)52-30-21-19-17-15-13-11-2/h22-28,31-34,49-50H,10-21,29-30H2,1-9H3/b48-33-/t34-/m1/s1 |
| InChIKey | PXRBLINLPJECJI-BYIHMUODSA-N |
| XLogP | 12.35 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.05 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|