C38H53NO2 — CID 136722731
2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]phenol (PubChem CID 136722731) has the molecular formula C38H53NO2 and a molecular weight of 555.85 g/mol. Its IUPAC name is 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]phenol.
| Compound Name | 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136722731 |
| Molecular Formula | C38H53NO2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 555.41 |
| IUPAC Name | 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]phenol |
| SMILES | C[C@H](/N=C\c1ccccc1O)C(O)(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H53NO2/c1-25(39-24-26-16-14-15-17-33(26)40)38(41,31-20-27(34(2,3)4)18-28(21-31)35(5,6)7)32-22-29(36(8,9)10)19-30(23-32)37(11,12)13/h14-25,40-41H,1-13H3/b39-24-/t25-/m0/s1 |
| InChIKey | GYDROZMPHURHBA-HEPGXXNFSA-N |
| XLogP | 9.33 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|