C38H52ClNO2 — CID 136722734
2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]-4-chlorophenol (PubChem CID 136722734) has the molecular formula C38H52ClNO2 and a molecular weight of 590.29 g/mol. Its IUPAC name is 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]-4-chlorophenol.
| Compound Name | 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]-4-chlorophenol |
|---|---|
| PubChem CID | 136722734 |
| Molecular Formula | C38H52ClNO2 |
| Molecular Weight | 590.29 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | 2-[[(2S)-1,1-bis(3,5-ditert-butylphenyl)-1-hydroxypropan-2-yl]iminomethyl]-4-chlorophenol |
| SMILES | C[C@H](/N=C\c1cc(Cl)ccc1O)C(O)(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H52ClNO2/c1-24(40-23-25-16-32(39)14-15-33(25)41)38(42,30-19-26(34(2,3)4)17-27(20-30)35(5,6)7)31-21-28(36(8,9)10)18-29(22-31)37(11,12)13/h14-24,41-42H,1-13H3/b40-23-/t24-/m0/s1 |
| InChIKey | ILGVFMKMIFSHJW-PFSOFZSESA-N |
| XLogP | 9.98 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.29 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|