C10H10ClNO3 — CID 136916103
(2S)-2-[(5-chloro-2-hydroxyphenyl)methylideneamino]propanoic acid (PubChem CID 136916103) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-2-hydroxyphenyl)methylideneamino]propanoic acid.
| Compound Name | (2S)-2-[(5-chloro-2-hydroxyphenyl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 136916103 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2S)-2-[(5-chloro-2-hydroxyphenyl)methylideneamino]propanoic acid |
| SMILES | C[C@H](/N=C/c1cc(Cl)ccc1O)C(=O)O |
| InChI | InChI=1S/C10H10ClNO3/c1-6(10(14)15)12-5-7-4-8(11)2-3-9(7)13/h2-6,13H,1H3,(H,14,15)/b12-5+/t6-/m0/s1 |
| InChIKey | ISYLGNPFJBRFSR-XDZJJNIASA-N |
| XLogP | 1.94 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|