C10H9Cl2NO2 — CID 22236669
2-[(3,4-dichlorophenyl)methylideneamino]propanoic acid (PubChem CID 22236669) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylideneamino]propanoic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 22236669 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylideneamino]propanoic acid |
| SMILES | CC(/N=C/c1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H9Cl2NO2/c1-6(10(14)15)13-5-7-2-3-8(11)9(12)4-7/h2-6H,1H3,(H,14,15)/b13-5+ |
| InChIKey | UFHZGUBSMLNRDS-WLRTZDKTSA-N |
| XLogP | 2.89 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|