C20H13Cl2NO — CID 10784299
[4-[(3,4-dichlorophenyl)methylideneamino]phenyl]-phenylmethanone (PubChem CID 10784299) has the molecular formula C20H13Cl2NO and a molecular weight of 354.24 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methylideneamino]phenyl]-phenylmethanone.
| Compound Name | [4-[(3,4-dichlorophenyl)methylideneamino]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 10784299 |
| Molecular Formula | C20H13Cl2NO |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methylideneamino]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(/N=C/c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H13Cl2NO/c21-18-11-6-14(12-19(18)22)13-23-17-9-7-16(8-10-17)20(24)15-4-2-1-3-5-15/h1-13H/b23-13+ |
| InChIKey | BDAFEFFDJLQVAM-YDZHTSKRSA-N |
| XLogP | 5.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|