C12H14Cl2N2OS — CID 110193000
2-[(3,4-dichlorophenyl)methylideneamino]-4-methylsulfanylbutanamide (PubChem CID 110193000) has the molecular formula C12H14Cl2N2OS and a molecular weight of 305.23 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylideneamino]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylideneamino]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 110193000 |
| Molecular Formula | C12H14Cl2N2OS |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylideneamino]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(/N=C/c1ccc(Cl)c(Cl)c1)C(N)=O |
| InChI | InChI=1S/C12H14Cl2N2OS/c1-18-5-4-11(12(15)17)16-7-8-2-3-9(13)10(14)6-8/h2-3,6-7,11H,4-5H2,1H3,(H2,15,17)/b16-7+ |
| InChIKey | WMGHEOSHQQUCMQ-FRKPEAEDSA-N |
| XLogP | 3.02 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|