C14H8Cl4N2 — CID 6108687
(Z)-1-(3,4-dichlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]methanimine (PubChem CID 6108687) has the molecular formula C14H8Cl4N2 and a molecular weight of 346.04 g/mol. Its IUPAC name is (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]methanimine.
| Compound Name | (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]methanimine |
|---|---|
| PubChem CID | 6108687 |
| Molecular Formula | C14H8Cl4N2 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | (Z)-1-(3,4-dichlorophenyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]methanimine |
| SMILES | Clc1ccc(/C=N\N=C/c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C14H8Cl4N2/c15-11-3-1-9(5-13(11)17)7-19-20-8-10-2-4-12(16)14(18)6-10/h1-8H/b19-7-,20-8- |
| InChIKey | YBSMZQHLLSYRAG-DWVBSFERSA-N |
| XLogP | 5.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|