C13H18N2O — CID 71352667
(2R)-2-(benzylideneamino)-4-methylpentanamide (PubChem CID 71352667) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (2R)-2-(benzylideneamino)-4-methylpentanamide.
| Compound Name | (2R)-2-(benzylideneamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 71352667 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (2R)-2-(benzylideneamino)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](/N=C/c1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H18N2O/c1-10(2)8-12(13(14)16)15-9-11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3,(H2,14,16)/b15-9+/t12-/m1/s1 |
| InChIKey | SUMXMFBHMUUWAO-KMHUVPDISA-N |
| XLogP | 2.01 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|