C18H20N2 — CID 929328
N-[(2R,3R)-3-(benzylideneamino)butan-2-yl]-1-phenylmethanimine (PubChem CID 929328) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[(2R,3R)-3-(benzylideneamino)butan-2-yl]-1-phenylmethanimine.
| Compound Name | N-[(2R,3R)-3-(benzylideneamino)butan-2-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 929328 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[(2R,3R)-3-(benzylideneamino)butan-2-yl]-1-phenylmethanimine |
| SMILES | C[C@@H](/N=C/c1ccccc1)[C@@H](C)/N=C/c1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-15(19-13-17-9-5-3-6-10-17)16(2)20-14-18-11-7-4-8-12-18/h3-16H,1-2H3/b19-13+,20-14+/t15-,16-/m1/s1 |
| InChIKey | SRGCDOZVOIUMMF-XYGGEOSRSA-N |
| XLogP | 4.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|