C15H18N2O5 — CID 136861684
(2S)-2-[[3-[[(1S)-1-carboxyethyl]iminomethyl]-2-hydroxy-5-methylphenyl]methylideneamino]propanoic acid (PubChem CID 136861684) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2S)-2-[[3-[[(1S)-1-carboxyethyl]iminomethyl]-2-hydroxy-5-methylphenyl]methylideneamino]propanoic acid.
| Compound Name | (2S)-2-[[3-[[(1S)-1-carboxyethyl]iminomethyl]-2-hydroxy-5-methylphenyl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 136861684 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (2S)-2-[[3-[[(1S)-1-carboxyethyl]iminomethyl]-2-hydroxy-5-methylphenyl]methylideneamino]propanoic acid |
| SMILES | Cc1cc(/C=N/[C@@H](C)C(=O)O)c(O)c(/C=N/[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O5/c1-8-4-11(6-16-9(2)14(19)20)13(18)12(5-8)7-17-10(3)15(21)22/h4-7,9-10,18H,1-3H3,(H,19,20)(H,21,22)/b16-6+,17-7+/t9-,10-/m0/s1 |
| InChIKey | CUAXIAHELNWJPA-LPLNELNKSA-N |
| XLogP | 1.48 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|