C16H16ClNO2 — CID 136703874
4-chloro-2-[[2-hydroxy-2-(2-methylphenyl)ethyl]iminomethyl]phenol (PubChem CID 136703874) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 4-chloro-2-[[2-hydroxy-2-(2-methylphenyl)ethyl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[[2-hydroxy-2-(2-methylphenyl)ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136703874 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-chloro-2-[[2-hydroxy-2-(2-methylphenyl)ethyl]iminomethyl]phenol |
| SMILES | Cc1ccccc1C(O)C/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H16ClNO2/c1-11-4-2-3-5-14(11)16(20)10-18-9-12-8-13(17)6-7-15(12)19/h2-9,16,19-20H,10H2,1H3/b18-9+ |
| InChIKey | UETCRYOUCAGMPE-GIJQJNRQSA-N |
| XLogP | 3.51 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|