C19H22ClN2O+ — CID 135758278
4-chloro-2-[[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol (PubChem CID 135758278) has the molecular formula C19H22ClN2O+ and a molecular weight of 329.85 g/mol. Its IUPAC name is 4-chloro-2-[[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135758278 |
| Molecular Formula | C19H22ClN2O+ |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-chloro-2-[[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/C[C@@H](c1ccccc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C19H21ClN2O/c20-17-8-9-19(23)16(12-17)13-21-14-18(22-10-4-5-11-22)15-6-2-1-3-7-15/h1-3,6-9,12-13,18,23H,4-5,10-11,14H2/p+1/b21-13+/t18-/m0/s1 |
| InChIKey | PQZQADXYDAULIC-LANLRWRYSA-O |
| XLogP | 2.88 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|