C20H23Cl2N2O2+ — CID 135598194
2,4-dichloro-6-[[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol (PubChem CID 135598194) has the molecular formula C20H23Cl2N2O2+ and a molecular weight of 394.32 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135598194 |
| Molecular Formula | C20H23Cl2N2O2+ |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2,4-dichloro-6-[[(2R)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]iminomethyl]phenol |
| SMILES | COc1ccc([C@H](C/N=C/c2cc(Cl)cc(Cl)c2O)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-26-17-6-4-14(5-7-17)19(24-8-2-3-9-24)13-23-12-15-10-16(21)11-18(22)20(15)25/h4-7,10-12,19,25H,2-3,8-9,13H2,1H3/p+1/b23-12+/t19-/m0/s1 |
| InChIKey | OUVPGULDBGGPSN-DOUQRPAJSA-O |
| XLogP | 3.55 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|