C20H24ClN2O3+ — CID 135596196
4-chloro-2-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol (PubChem CID 135596196) has the molecular formula C20H24ClN2O3+ and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-chloro-2-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135596196 |
| Molecular Formula | C20H24ClN2O3+ |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-chloro-2-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
| SMILES | COc1ccc([C@@H](C/N=C/c2cc(Cl)ccc2O)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23ClN2O3/c1-25-18-5-2-15(3-6-18)19(23-8-10-26-11-9-23)14-22-13-16-12-17(21)4-7-20(16)24/h2-7,12-13,19,24H,8-11,14H2,1H3/p+1/b22-13+/t19-/m1/s1 |
| InChIKey | ARDBODZJPJUCGW-PPRFWAEMSA-O |
| XLogP | 2.13 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|