C24H33N2O5+ — CID 135596340
2-ethoxy-6-[[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol (PubChem CID 135596340) has the molecular formula C24H33N2O5+ and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-ethoxy-6-[[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol.
| Compound Name | 2-ethoxy-6-[[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135596340 |
| Molecular Formula | C24H33N2O5+ |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-ethoxy-6-[[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
| SMILES | CCOc1ccc(C(C/N=C/c2cccc(OCC)c2O)[NH+]2CCOCC2)cc1OC |
| InChI | InChI=1S/C24H32N2O5/c1-4-30-21-10-9-18(15-23(21)28-3)20(26-11-13-29-14-12-26)17-25-16-19-7-6-8-22(24(19)27)31-5-2/h6-10,15-16,20,27H,4-5,11-14,17H2,1-3H3/p+1/b25-16+ |
| InChIKey | XJUJCIFVCNJBCL-PCLIKHOPSA-O |
| XLogP | 2.27 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|