C23H31FN3O2+ — CID 135774385
5-(diethylamino)-2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol (PubChem CID 135774385) has the molecular formula C23H31FN3O2+ and a molecular weight of 400.52 g/mol. Its IUPAC name is 5-(diethylamino)-2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135774385 |
| Molecular Formula | C23H31FN3O2+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 5-(diethylamino)-2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/C[C@@H](c2ccc(F)cc2)[NH+]2CCOCC2)c(O)c1 |
| InChI | InChI=1S/C23H30FN3O2/c1-3-26(4-2)21-10-7-19(23(28)15-21)16-25-17-22(27-11-13-29-14-12-27)18-5-8-20(24)9-6-18/h5-10,15-16,22,28H,3-4,11-14,17H2,1-2H3/p+1/b25-16+/t22-/m0/s1 |
| InChIKey | XTUHPKQOSOODJW-LWROZRRASA-O |
| XLogP | 2.45 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|