C23H33N4O+ — CID 135774341
5-(diethylamino)-2-[[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]iminomethyl]phenol (PubChem CID 135774341) has the molecular formula C23H33N4O+ and a molecular weight of 381.54 g/mol. Its IUPAC name is 5-(diethylamino)-2-[[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]iminomethyl]phenol.
| Compound Name | 5-(diethylamino)-2-[[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135774341 |
| Molecular Formula | C23H33N4O+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 5-(diethylamino)-2-[[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]iminomethyl]phenol |
| SMILES | CCN(CC)c1ccc(/C=N/c2ccc(N3CC[NH+](CC)CC3)cc2)c(O)c1 |
| InChI | InChI=1S/C23H32N4O/c1-4-25-13-15-27(16-14-25)21-11-8-20(9-12-21)24-18-19-7-10-22(17-23(19)28)26(5-2)6-3/h7-12,17-18,28H,4-6,13-16H2,1-3H3/p+1/b24-18+ |
| InChIKey | MGWNKTWGNJHWOA-HKOYGPOVSA-O |
| XLogP | 2.71 |
| TPSA | 43.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|